About 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one
5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one (PubChem CID 22714175) has the molecular formula C18H18ClN5O2
and a molecular weight of 371.83 g/mol. Its IUPAC name is 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one |
| PubChem CID | 22714175 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one |
| SMILES | Cc1onc2c1c(=O)n(C1CCCC(CN=[N+]=[N-])C1)c1cccc(Cl)c21 |
| InChI | InChI=1S/C18H18ClN5O2/c1-10-15-17(22-26-10)16-13(19)6-3-7-14(16)24(18(15)25)12-5-2-4-11(8-12)9-21-23-20/h3,6-7,11-12H,2,4-5,8-9H2,1H3 |
| InChIKey | DFQTVMOMFCFFTN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one?
The IUPAC name of 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one (CID 22714175) is 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one.
What is the SMILES notation for 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one?
The canonical SMILES for 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one is Cc1onc2c1c(=O)n(C1CCCC(CN=[N+]=[N-])C1)c1cccc(Cl)c21.
What is the InChIKey of 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one?
The InChIKey is DFQTVMOMFCFFTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN5O2/c1-10-15-17(22-26-10)16-13(19)6-3-7-14(16)24(18(15)25)12-5-2-4-11(8-12)9-21-23-20/h3,6-7,11-12H,2,4-5,8-9H2,1H3.
What are the key properties of 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one?
5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one has a molecular weight of 371.83 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(azidomethyl)cyclohexyl]-9-chloro-3-methyl-[1,2]oxazolo[4,3-c]quinolin-4-one is sourced from PubChem (CID 22714175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).