About 5-methylsulfinyl-1,3-thiazol-2-amine
5-methylsulfinyl-1,3-thiazol-2-amine (PubChem CID 22714584) has the molecular formula C4H6N2OS2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-methylsulfinyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methylsulfinyl-1,3-thiazol-2-amine |
| PubChem CID | 22714584 |
| Molecular Formula | C4H6N2OS2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | 5-methylsulfinyl-1,3-thiazol-2-amine |
| SMILES | CS(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C4H6N2OS2/c1-9(7)3-2-6-4(5)8-3/h2H,1H3,(H2,5,6) |
| InChIKey | SYNJIJRKFUNUFR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylsulfinyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfinyl-1,3-thiazol-2-amine?
The IUPAC name of 5-methylsulfinyl-1,3-thiazol-2-amine (CID 22714584) is 5-methylsulfinyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methylsulfinyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-methylsulfinyl-1,3-thiazol-2-amine is CS(=O)c1cnc(N)s1.
What is the InChIKey of 5-methylsulfinyl-1,3-thiazol-2-amine?
The InChIKey is SYNJIJRKFUNUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS2/c1-9(7)3-2-6-4(5)8-3/h2H,1H3,(H2,5,6).
What are the key properties of 5-methylsulfinyl-1,3-thiazol-2-amine?
5-methylsulfinyl-1,3-thiazol-2-amine has a molecular weight of 162.24 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfinyl-1,3-thiazol-2-amine is sourced from PubChem (CID 22714584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).