About [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol
[4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol (PubChem CID 22714952) has the molecular formula C9H11N5O3
and a molecular weight of 237.22 g/mol. Its IUPAC name is [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol |
| PubChem CID | 22714952 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol |
| SMILES | Nc1ncc2[nH]c(C3COC(CO)O3)nc2n1 |
| InChI | InChI=1S/C9H11N5O3/c10-9-11-1-4-7(14-9)13-8(12-4)5-3-16-6(2-15)17-5/h1,5-6,15H,2-3H2,(H3,10,11,12,13,14) |
| InChIKey | KPIICPYNCQTJCH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 119.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol?
The IUPAC name of [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol (CID 22714952) is [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol.
What is the SMILES notation for [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol?
The canonical SMILES for [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol is Nc1ncc2[nH]c(C3COC(CO)O3)nc2n1.
What is the InChIKey of [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol?
The InChIKey is KPIICPYNCQTJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3/c10-9-11-1-4-7(14-9)13-8(12-4)5-3-16-6(2-15)17-5/h1,5-6,15H,2-3H2,(H3,10,11,12,13,14).
What are the key properties of [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol?
[4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol has a molecular weight of 237.22 g/mol, XLogP of -0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-amino-7H-purin-8-yl)-1,3-dioxolan-2-yl]methanol is sourced from PubChem (CID 22714952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).