About 3,5-dibromo-N,N-diethylpyridin-4-amine
3,5-dibromo-N,N-diethylpyridin-4-amine (PubChem CID 22715019) has the molecular formula C9H12Br2N2
and a molecular weight of 308.02 g/mol. Its IUPAC name is 3,5-dibromo-N,N-diethylpyridin-4-amine.
Molecular Properties
| Compound Name | 3,5-dibromo-N,N-diethylpyridin-4-amine |
| PubChem CID | 22715019 |
| Molecular Formula | C9H12Br2N2 |
| Molecular Weight | 308.02 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 3,5-dibromo-N,N-diethylpyridin-4-amine |
| SMILES | CCN(CC)c1c(Br)cncc1Br |
| InChI | InChI=1S/C9H12Br2N2/c1-3-13(4-2)9-7(10)5-12-6-8(9)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | PZDMZOVZJDDAGS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dibromo-N,N-diethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-N,N-diethylpyridin-4-amine?
The IUPAC name of 3,5-dibromo-N,N-diethylpyridin-4-amine (CID 22715019) is 3,5-dibromo-N,N-diethylpyridin-4-amine.
What is the SMILES notation for 3,5-dibromo-N,N-diethylpyridin-4-amine?
The canonical SMILES for 3,5-dibromo-N,N-diethylpyridin-4-amine is CCN(CC)c1c(Br)cncc1Br.
What is the InChIKey of 3,5-dibromo-N,N-diethylpyridin-4-amine?
The InChIKey is PZDMZOVZJDDAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Br2N2/c1-3-13(4-2)9-7(10)5-12-6-8(9)11/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,5-dibromo-N,N-diethylpyridin-4-amine?
3,5-dibromo-N,N-diethylpyridin-4-amine has a molecular weight of 308.02 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-N,N-diethylpyridin-4-amine is sourced from PubChem (CID 22715019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).