C15H24N2O5S — CID 2271520
N-[(2R)-butan-2-yl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 2271520) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2271520 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | CC[C@@H](C)NC(=O)CN(c1ccc(OC)c(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O5S/c1-6-11(2)16-15(18)10-17(23(5,19)20)12-7-8-13(21-3)14(9-12)22-4/h7-9,11H,6,10H2,1-5H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | YVPFQCWDWFXCFE-LLVKDONJSA-N |
| XLogP | 1.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |