C25H34O8 — CID 22715251
1-O,2-O,4-O-tris(2-methylprop-2-enyl) 5-O-prop-2-enyl cyclohexane-1,2,4,5-tetracarboxylate (PubChem CID 22715251) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is 1-O,2-O,4-O-tris(2-methylprop-2-enyl) 5-O-prop-2-enyl cyclohexane-1,2,4,5-tetracarboxylate.
| Compound Name | 1-O,2-O,4-O-tris(2-methylprop-2-enyl) 5-O-prop-2-enyl cyclohexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 22715251 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-O,2-O,4-O-tris(2-methylprop-2-enyl) 5-O-prop-2-enyl cyclohexane-1,2,4,5-tetracarboxylate |
| SMILES | C=CCOC(=O)C1CC(C(=O)OCC(=C)C)C(C(=O)OCC(=C)C)CC1C(=O)OCC(=C)C |
| InChI | InChI=1S/C25H34O8/c1-8-9-30-22(26)18-10-20(24(28)32-13-16(4)5)21(25(29)33-14-17(6)7)11-19(18)23(27)31-12-15(2)3/h8,18-21H,1-2,4,6,9-14H2,3,5,7H3 |
| InChIKey | HNHAPMMYXBTLPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|