About N-cyclohexyl-N'-(4-methylphenyl)oxamide
N-cyclohexyl-N'-(4-methylphenyl)oxamide (PubChem CID 2271538) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-cyclohexyl-N'-(4-methylphenyl)oxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-(4-methylphenyl)oxamide |
| PubChem CID | 2271538 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-cyclohexyl-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2O2/c1-11-7-9-13(10-8-11)17-15(19)14(18)16-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | HRWJGXIYQYXHPZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N'-(4-methylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-(4-methylphenyl)oxamide?
The IUPAC name of N-cyclohexyl-N'-(4-methylphenyl)oxamide (CID 2271538) is N-cyclohexyl-N'-(4-methylphenyl)oxamide.
What is the SMILES notation for N-cyclohexyl-N'-(4-methylphenyl)oxamide?
The canonical SMILES for N-cyclohexyl-N'-(4-methylphenyl)oxamide is Cc1ccc(NC(=O)C(=O)NC2CCCCC2)cc1.
What is the InChIKey of N-cyclohexyl-N'-(4-methylphenyl)oxamide?
The InChIKey is HRWJGXIYQYXHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-11-7-9-13(10-8-11)17-15(19)14(18)16-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,16,18)(H,17,19).
What are the key properties of N-cyclohexyl-N'-(4-methylphenyl)oxamide?
N-cyclohexyl-N'-(4-methylphenyl)oxamide has a molecular weight of 260.34 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-(4-methylphenyl)oxamide is sourced from PubChem (CID 2271538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).