About 4-methyloxetan-2-one;oxetan-2-one
4-methyloxetan-2-one;oxetan-2-one (PubChem CID 22715627) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 4-methyloxetan-2-one;oxetan-2-one.
Molecular Properties
| Compound Name | 4-methyloxetan-2-one;oxetan-2-one |
| PubChem CID | 22715627 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-methyloxetan-2-one;oxetan-2-one |
| SMILES | CC1CC(=O)O1.O=C1CCO1 |
| InChI | InChI=1S/C4H6O2.C3H4O2/c1-3-2-4(5)6-3;4-3-1-2-5-3/h3H,2H2,1H3;1-2H2 |
| InChIKey | SBBFDNFGDQHULF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 4-methyloxetan-2-one;oxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloxetan-2-one;oxetan-2-one?
The IUPAC name of 4-methyloxetan-2-one;oxetan-2-one (CID 22715627) is 4-methyloxetan-2-one;oxetan-2-one.
What is the SMILES notation for 4-methyloxetan-2-one;oxetan-2-one?
The canonical SMILES for 4-methyloxetan-2-one;oxetan-2-one is CC1CC(=O)O1.O=C1CCO1.
What is the InChIKey of 4-methyloxetan-2-one;oxetan-2-one?
The InChIKey is SBBFDNFGDQHULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H4O2/c1-3-2-4(5)6-3;4-3-1-2-5-3/h3H,2H2,1H3;1-2H2.
What are the key properties of 4-methyloxetan-2-one;oxetan-2-one?
4-methyloxetan-2-one;oxetan-2-one has a molecular weight of 158.15 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloxetan-2-one;oxetan-2-one is sourced from PubChem (CID 22715627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).