C20H18N2O4 — CID 22716428
2,3,8,9-tetramethoxynaphtho[1,2-c]cinnoline (PubChem CID 22716428) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2,3,8,9-tetramethoxynaphtho[1,2-c]cinnoline.
| Compound Name | 2,3,8,9-tetramethoxynaphtho[1,2-c]cinnoline |
|---|---|
| PubChem CID | 22716428 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2,3,8,9-tetramethoxynaphtho[1,2-c]cinnoline |
| SMILES | COc1cc2ccc3c4cc(OC)c(OC)cc4nnc3c2cc1OC |
| InChI | InChI=1S/C20H18N2O4/c1-23-16-7-11-5-6-12-14-9-18(25-3)19(26-4)10-15(14)21-22-20(12)13(11)8-17(16)24-2/h5-10H,1-4H3 |
| InChIKey | OMUIGKAGIWPDCY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|