About 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline
2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline (PubChem CID 22716431) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline.
Molecular Properties
| Compound Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline |
| PubChem CID | 22716431 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)c(-c2ccc3cc(OC)c(OC)cc3c2)c1 |
| InChI | InChI=1S/C19H19NO3/c1-21-15-6-7-17(20)16(11-15)13-5-4-12-9-18(22-2)19(23-3)10-14(12)8-13/h4-11H,20H2,1-3H3 |
| InChIKey | DUHXKKFPSASCAQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline?
The IUPAC name of 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline (CID 22716431) is 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline.
What is the SMILES notation for 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline?
The canonical SMILES for 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline is COc1ccc(N)c(-c2ccc3cc(OC)c(OC)cc3c2)c1.
What is the InChIKey of 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline?
The InChIKey is DUHXKKFPSASCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-21-15-6-7-17(20)16(11-15)13-5-4-12-9-18(22-2)19(23-3)10-14(12)8-13/h4-11H,20H2,1-3H3.
What are the key properties of 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline?
2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline has a molecular weight of 309.37 g/mol, XLogP of 4.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethoxynaphthalen-2-yl)-4-methoxyaniline is sourced from PubChem (CID 22716431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).