About 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline
2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline (PubChem CID 22716434) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline |
| PubChem CID | 22716434 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(-c2ccc3cc(OC)c(OC)cc3c2)cc1OC |
| InChI | InChI=1S/C20H21NO4/c1-22-17-8-12-5-6-13(7-14(12)9-18(17)23-2)15-10-19(24-3)20(25-4)11-16(15)21/h5-11H,21H2,1-4H3 |
| InChIKey | MVXFWIJIPARTPT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline?
The IUPAC name of 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline (CID 22716434) is 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline.
What is the SMILES notation for 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline?
The canonical SMILES for 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline is COc1cc(N)c(-c2ccc3cc(OC)c(OC)cc3c2)cc1OC.
What is the InChIKey of 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline?
The InChIKey is MVXFWIJIPARTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4/c1-22-17-8-12-5-6-13(7-14(12)9-18(17)23-2)15-10-19(24-3)20(25-4)11-16(15)21/h5-11H,21H2,1-4H3.
What are the key properties of 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline?
2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline has a molecular weight of 339.39 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline is sourced from PubChem (CID 22716434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).