methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate

C11H9F2N3O2 — CID 22716778

IUPACmethyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate
SMILESCOC(=O)c1cn(Cc2c(F)cccc2F)nn1
InChIInChI=1S/C11H9F2N3O2/c1-18-11(17)10-6-16(15-14-10)5-7-8(12)3-2-4-9(7)13/h2-4,6H,5H2,1H3
InChIKeyXVEURJOWGBWEPY-UHFFFAOYSA-N
MW253.21 g/mol
LogP1.39
Rot. Bonds3

About methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate

methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate (PubChem CID 22716778) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate
PubChem CID22716778
Molecular FormulaC11H9F2N3O2
Molecular Weight253.21 g/mol
Exact Mass253.07
IUPAC Namemethyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate
SMILESCOC(=O)c1cn(Cc2c(F)cccc2F)nn1
InChIInChI=1S/C11H9F2N3O2/c1-18-11(17)10-6-16(15-14-10)5-7-8(12)3-2-4-9(7)13/h2-4,6H,5H2,1H3
InChIKeyXVEURJOWGBWEPY-UHFFFAOYSA-N
XLogP1.39
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.21
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate (CID 22716778) is methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate is COC(=O)c1cn(Cc2c(F)cccc2F)nn1.
What is the InChIKey of methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate?
The InChIKey is XVEURJOWGBWEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N3O2/c1-18-11(17)10-6-16(15-14-10)5-7-8(12)3-2-4-9(7)13/h2-4,6H,5H2,1H3.
What are the key properties of methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate?
methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate has a molecular weight of 253.21 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylate is sourced from PubChem (CID 22716778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).