C20H16N2O2 — CID 22717418
cyclohexa-2,5-diene-1,4-dione;2,9-dimethyl-1,10-phenanthroline (PubChem CID 22717418) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2,9-dimethyl-1,10-phenanthroline.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2,9-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 22717418 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C14H12N2.C6H4O2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;7-5-1-2-6(8)4-3-5/h3-8H,1-2H3;1-4H |
| InChIKey | NPNRPUPGJKKVAZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|