About 2-hexyl-2,4-dimethyl-1,3-dioxane
2-hexyl-2,4-dimethyl-1,3-dioxane (PubChem CID 22718) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-hexyl-2,4-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-hexyl-2,4-dimethyl-1,3-dioxane |
| PubChem CID | 22718 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2-hexyl-2,4-dimethyl-1,3-dioxane |
| SMILES | CCCCCCC1(C)OCCC(C)O1 |
| InChI | InChI=1S/C12H24O2/c1-4-5-6-7-9-12(3)13-10-8-11(2)14-12/h11H,4-10H2,1-3H3 |
| InChIKey | WJCBEYZNPAIPMV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-2,4-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-2,4-dimethyl-1,3-dioxane?
The IUPAC name of 2-hexyl-2,4-dimethyl-1,3-dioxane (CID 22718) is 2-hexyl-2,4-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-hexyl-2,4-dimethyl-1,3-dioxane?
The canonical SMILES for 2-hexyl-2,4-dimethyl-1,3-dioxane is CCCCCCC1(C)OCCC(C)O1.
What is the InChIKey of 2-hexyl-2,4-dimethyl-1,3-dioxane?
The InChIKey is WJCBEYZNPAIPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-4-5-6-7-9-12(3)13-10-8-11(2)14-12/h11H,4-10H2,1-3H3.
What are the key properties of 2-hexyl-2,4-dimethyl-1,3-dioxane?
2-hexyl-2,4-dimethyl-1,3-dioxane has a molecular weight of 200.32 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-2,4-dimethyl-1,3-dioxane is sourced from PubChem (CID 22718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).