C32H37F5O4 — CID 22718015
11-[6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid (PubChem CID 22718015) has the molecular formula C32H37F5O4 and a molecular weight of 580.63 g/mol. Its IUPAC name is 11-[6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid.
| Compound Name | 11-[6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
|---|---|
| PubChem CID | 22718015 |
| Molecular Formula | C32H37F5O4 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 11-[6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)undecanoic acid |
| SMILES | O=C(O)C(CCCCCCCCCc1c(-c2ccc(O)cc2)ccc2cc(O)ccc12)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H37F5O4/c33-31(34,32(35,36)37)20-8-10-23(30(40)41)9-6-4-2-1-3-5-7-11-29-27(22-12-15-25(38)16-13-22)18-14-24-21-26(39)17-19-28(24)29/h12-19,21,23,38-39H,1-11,20H2,(H,40,41) |
| InChIKey | SOBQWHOYJMPVGZ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|