C33H38F6O4 — CID 22718019
12-[2-(3-fluoro-4-hydroxyphenyl)-6-hydroxynaphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)dodecanoic acid (PubChem CID 22718019) has the molecular formula C33H38F6O4 and a molecular weight of 612.65 g/mol. Its IUPAC name is 12-[2-(3-fluoro-4-hydroxyphenyl)-6-hydroxynaphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)dodecanoic acid.
| Compound Name | 12-[2-(3-fluoro-4-hydroxyphenyl)-6-hydroxynaphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)dodecanoic acid |
|---|---|
| PubChem CID | 22718019 |
| Molecular Formula | C33H38F6O4 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 12-[2-(3-fluoro-4-hydroxyphenyl)-6-hydroxynaphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)dodecanoic acid |
| SMILES | O=C(O)C(CCCCCCCCCCc1c(-c2ccc(O)c(F)c2)ccc2cc(O)ccc12)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H38F6O4/c34-29-21-24(14-18-30(29)41)26-16-13-23-20-25(40)15-17-27(23)28(26)12-8-6-4-2-1-3-5-7-10-22(31(42)43)11-9-19-32(35,36)33(37,38)39/h13-18,20-22,40-41H,1-12,19H2,(H,42,43) |
| InChIKey | AYNXXUYPZMUALQ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|