C32H37F5O4 — CID 22718042
9-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid (PubChem CID 22718042) has the molecular formula C32H37F5O4 and a molecular weight of 580.63 g/mol. Its IUPAC name is 9-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid.
| Compound Name | 9-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid |
|---|---|
| PubChem CID | 22718042 |
| Molecular Formula | C32H37F5O4 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 9-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]-2-(4,4,5,5,5-pentafluoropentyl)nonanoic acid |
| SMILES | COc1ccc(-c2ccc3cc(OC)ccc3c2CCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C32H37F5O4/c1-40-25-15-12-22(13-16-25)27-18-14-24-21-26(41-2)17-19-28(24)29(27)11-7-5-3-4-6-9-23(30(38)39)10-8-20-31(33,34)32(35,36)37/h12-19,21,23H,3-11,20H2,1-2H3,(H,38,39) |
| InChIKey | NKQGMSKRKTVFKM-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|