About [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate
[4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate (PubChem CID 2271814) has the molecular formula C23H14Cl2O5
and a molecular weight of 441.27 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate.
Molecular Properties
| Compound Name | [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate |
| PubChem CID | 2271814 |
| Molecular Formula | C23H14Cl2O5 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate |
| SMILES | COc1ccc(-c2cc(=O)oc3cc(OC(=O)c4ccc(Cl)cc4Cl)ccc23)cc1 |
| InChI | InChI=1S/C23H14Cl2O5/c1-28-15-5-2-13(3-6-15)19-12-22(26)30-21-11-16(7-9-17(19)21)29-23(27)18-8-4-14(24)10-20(18)25/h2-12H,1H3 |
| InChIKey | JYRJQHWFUKVBRU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate?
The IUPAC name of [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate (CID 2271814) is [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate.
What is the SMILES notation for [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate?
The canonical SMILES for [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate is COc1ccc(-c2cc(=O)oc3cc(OC(=O)c4ccc(Cl)cc4Cl)ccc23)cc1.
What is the InChIKey of [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate?
The InChIKey is JYRJQHWFUKVBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2O5/c1-28-15-5-2-13(3-6-15)19-12-22(26)30-21-11-16(7-9-17(19)21)29-23(27)18-8-4-14(24)10-20(18)25/h2-12H,1H3.
What are the key properties of [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate?
[4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate has a molecular weight of 441.27 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methoxyphenyl)-2-oxochromen-7-yl] 2,4-dichlorobenzoate is sourced from PubChem (CID 2271814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).