C12H14N2O2 — CID 22718532
N-[3-(1,3-benzoxazol-7-yl)propyl]acetamide (PubChem CID 22718532) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-7-yl)propyl]acetamide.
| Compound Name | N-[3-(1,3-benzoxazol-7-yl)propyl]acetamide |
|---|---|
| PubChem CID | 22718532 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-[3-(1,3-benzoxazol-7-yl)propyl]acetamide |
| SMILES | CC(=O)NCCCc1cccc2ncoc12 |
| InChI | InChI=1S/C12H14N2O2/c1-9(15)13-7-3-5-10-4-2-6-11-12(10)16-8-14-11/h2,4,6,8H,3,5,7H2,1H3,(H,13,15) |
| InChIKey | UVCQHPPYUDDOEQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|