About 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile
4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile (PubChem CID 22718687) has the molecular formula C17H12F2N4
and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile.
Molecular Properties
| Compound Name | 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile |
| PubChem CID | 22718687 |
| Molecular Formula | C17H12F2N4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile |
| SMILES | N#Cc1ccc(N(Cc2cc(F)cc(F)c2)n2ccnc2)cc1 |
| InChI | InChI=1S/C17H12F2N4/c18-15-7-14(8-16(19)9-15)11-23(22-6-5-21-12-22)17-3-1-13(10-20)2-4-17/h1-9,12H,11H2 |
| InChIKey | ZCUDHUSUXXXJEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile?
The IUPAC name of 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile (CID 22718687) is 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile.
What is the SMILES notation for 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile?
The canonical SMILES for 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile is N#Cc1ccc(N(Cc2cc(F)cc(F)c2)n2ccnc2)cc1.
What is the InChIKey of 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile?
The InChIKey is ZCUDHUSUXXXJEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N4/c18-15-7-14(8-16(19)9-15)11-23(22-6-5-21-12-22)17-3-1-13(10-20)2-4-17/h1-9,12H,11H2.
What are the key properties of 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile?
4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile has a molecular weight of 310.31 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-difluorophenyl)methyl-imidazol-1-ylamino]benzonitrile is sourced from PubChem (CID 22718687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).