About (2-cyclohexylphenyl) dihydrogen phosphite
(2-cyclohexylphenyl) dihydrogen phosphite (PubChem CID 22719070) has the molecular formula C12H17O3P
and a molecular weight of 240.24 g/mol. Its IUPAC name is (2-cyclohexylphenyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | (2-cyclohexylphenyl) dihydrogen phosphite |
| PubChem CID | 22719070 |
| Molecular Formula | C12H17O3P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2-cyclohexylphenyl) dihydrogen phosphite |
| SMILES | OP(O)Oc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C12H17O3P/c13-16(14)15-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10,13-14H,1-3,6-7H2 |
| InChIKey | KGNBMBRYHMHVFZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclohexylphenyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexylphenyl) dihydrogen phosphite?
The IUPAC name of (2-cyclohexylphenyl) dihydrogen phosphite (CID 22719070) is (2-cyclohexylphenyl) dihydrogen phosphite.
What is the SMILES notation for (2-cyclohexylphenyl) dihydrogen phosphite?
The canonical SMILES for (2-cyclohexylphenyl) dihydrogen phosphite is OP(O)Oc1ccccc1C1CCCCC1.
What is the InChIKey of (2-cyclohexylphenyl) dihydrogen phosphite?
The InChIKey is KGNBMBRYHMHVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O3P/c13-16(14)15-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10,13-14H,1-3,6-7H2.
What are the key properties of (2-cyclohexylphenyl) dihydrogen phosphite?
(2-cyclohexylphenyl) dihydrogen phosphite has a molecular weight of 240.24 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexylphenyl) dihydrogen phosphite is sourced from PubChem (CID 22719070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).