C12H6F16O2 — CID 22719158
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl 2-methylprop-2-enoate (PubChem CID 22719158) has the molecular formula C12H6F16O2 and a molecular weight of 486.15 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl 2-methylprop-2-enoate.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22719158 |
| Molecular Formula | C12H6F16O2 |
| Molecular Weight | 486.15 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F16O2/c1-3(2)4(29)30-5(13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)28/h5H,1H2,2H3 |
| InChIKey | LBMRGFURPWRBCI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.15 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|