C13H11Cl2N5O4 — CID 22719248
(E)-but-2-enedioic acid;6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 22719248) has the molecular formula C13H11Cl2N5O4 and a molecular weight of 372.17 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | (E)-but-2-enedioic acid;6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22719248 |
| Molecular Formula | C13H11Cl2N5O4 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | (E)-but-2-enedioic acid;6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cc(Cl)ccc2Cl)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H7Cl2N5.C4H4O4/c10-4-1-2-6(11)5(3-4)7-14-8(12)16-9(13)15-7;5-3(6)1-2-4(7)8/h1-3H,(H4,12,13,14,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PJLVTVAIERNDEQ-WLHGVMLRSA-N |
| XLogP | 1.72 |
| TPSA | 165.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|