C21H19Cl2N3O3 — CID 22719976
3-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride (PubChem CID 22719976) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride |
|---|---|
| PubChem CID | 22719976 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-1-(2-methoxyethyl)-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride |
| SMILES | COCCn1c2c([n+](Cc3ccc(Cl)nc3)c1C)C(=O)c1ccccc1C2=O.[Cl-] |
| InChI | InChI=1S/C21H19ClN3O3.ClH/c1-13-24(9-10-28-2)18-19(25(13)12-14-7-8-17(22)23-11-14)21(27)16-6-4-3-5-15(16)20(18)26;/h3-8,11H,9-10,12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UJQDCYHZDBWGHO-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|