About 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol
3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 22720131) has the molecular formula C15H12Cl4O2
and a molecular weight of 366.07 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol.
Molecular Properties
| Compound Name | 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol |
| PubChem CID | 22720131 |
| Molecular Formula | C15H12Cl4O2 |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1c(Cl)cc(O)cc1Cl)c1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C15H12Cl4O2/c1-15(2,13-9(16)3-7(20)4-10(13)17)14-11(18)5-8(21)6-12(14)19/h3-6,20-21H,1-2H3 |
| InChIKey | PPRWTMVSNOOMDW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol?
The IUPAC name of 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol (CID 22720131) is 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol.
What is the SMILES notation for 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol?
The canonical SMILES for 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol is CC(C)(c1c(Cl)cc(O)cc1Cl)c1c(Cl)cc(O)cc1Cl.
What is the InChIKey of 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol?
The InChIKey is PPRWTMVSNOOMDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl4O2/c1-15(2,13-9(16)3-7(20)4-10(13)17)14-11(18)5-8(21)6-12(14)19/h3-6,20-21H,1-2H3.
What are the key properties of 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol?
3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol has a molecular weight of 366.07 g/mol, XLogP of 6.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-[2-(2,6-dichloro-4-hydroxyphenyl)propan-2-yl]phenol is sourced from PubChem (CID 22720131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).