C8H9F9O4S2 — CID 22720165
1-butylsulfonylsulfonyl-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 22720165) has the molecular formula C8H9F9O4S2 and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-butylsulfonylsulfonyl-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-butylsulfonylsulfonyl-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 22720165 |
| Molecular Formula | C8H9F9O4S2 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 1-butylsulfonylsulfonyl-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | CCCCS(=O)(=O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O4S2/c1-2-3-4-22(18,19)23(20,21)8(16,17)6(11,12)5(9,10)7(13,14)15/h2-4H2,1H3 |
| InChIKey | WVPYWOMPNIGQED-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|