C18H19ClN2 — CID 22720368
9-(4-chlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole (PubChem CID 22720368) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole.
| Compound Name | 9-(4-chlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
|---|---|
| PubChem CID | 22720368 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 9-(4-chlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
| SMILES | Clc1ccc(-c2ccc3c(c2)CC2CCNCCN32)cc1 |
| InChI | InChI=1S/C18H19ClN2/c19-16-4-1-13(2-5-16)14-3-6-18-15(11-14)12-17-7-8-20-9-10-21(17)18/h1-6,11,17,20H,7-10,12H2 |
| InChIKey | FOQPVICTJFOEDT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |