C18H17Cl3N2 — CID 22720500
7-(2,4,6-trichlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole (PubChem CID 22720500) has the molecular formula C18H17Cl3N2 and a molecular weight of 367.71 g/mol. Its IUPAC name is 7-(2,4,6-trichlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole.
| Compound Name | 7-(2,4,6-trichlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
|---|---|
| PubChem CID | 22720500 |
| Molecular Formula | C18H17Cl3N2 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 7-(2,4,6-trichlorophenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
| SMILES | Clc1cc(Cl)c(-c2cccc3c2N2CCNCCC2C3)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3N2/c19-12-9-15(20)17(16(21)10-12)14-3-1-2-11-8-13-4-5-22-6-7-23(13)18(11)14/h1-3,9-10,13,22H,4-8H2 |
| InChIKey | ISPJMYOVAMTHRG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |