C20H24N2O2 — CID 22720607
9-(2,4-dimethoxyphenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole (PubChem CID 22720607) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 9-(2,4-dimethoxyphenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole.
| Compound Name | 9-(2,4-dimethoxyphenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
|---|---|
| PubChem CID | 22720607 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 9-(2,4-dimethoxyphenyl)-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
| SMILES | COc1ccc(-c2ccc3c(c2)CC2CCNCCN32)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-23-17-4-5-18(20(13-17)24-2)14-3-6-19-15(11-14)12-16-7-8-21-9-10-22(16)19/h3-6,11,13,16,21H,7-10,12H2,1-2H3 |
| InChIKey | BJFHJNKTMUCRMY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |