C19H21N5O2 — CID 22720721
N-(2-ethylpyrazol-3-yl)-2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)acetamide (PubChem CID 22720721) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-ethylpyrazol-3-yl)-2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)acetamide.
| Compound Name | N-(2-ethylpyrazol-3-yl)-2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)acetamide |
|---|---|
| PubChem CID | 22720721 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-(2-ethylpyrazol-3-yl)-2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)acetamide |
| SMILES | CCn1nccc1NC(=O)C(=O)c1c2n(c3ccccc13)CCNCC2 |
| InChI | InChI=1S/C19H21N5O2/c1-2-24-16(8-10-21-24)22-19(26)18(25)17-13-5-3-4-6-14(13)23-12-11-20-9-7-15(17)23/h3-6,8,10,20H,2,7,9,11-12H2,1H3,(H,22,26) |
| InChIKey | RKPRZSUZYSDTJO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|