C19H22N2 — CID 22720820
9-benzyl-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole (PubChem CID 22720820) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 9-benzyl-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole.
| Compound Name | 9-benzyl-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
|---|---|
| PubChem CID | 22720820 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 9-benzyl-2,3,4,5,11,11a-hexahydro-1H-[1,4]diazepino[1,7-a]indole |
| SMILES | c1ccc(Cc2ccc3c(c2)CC2CCNCCN32)cc1 |
| InChI | InChI=1S/C19H22N2/c1-2-4-15(5-3-1)12-16-6-7-19-17(13-16)14-18-8-9-20-10-11-21(18)19/h1-7,13,18,20H,8-12,14H2 |
| InChIKey | RIBQGXFCOHFSHO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |