C64H26F16N8 — CID 22721619
5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,23-dihydroporphyrin (PubChem CID 22721619) has the molecular formula C64H26F16N8 and a molecular weight of 1210.94 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 22721619 |
| Molecular Formula | C64H26F16N8 |
| Molecular Weight | 1210.94 g/mol |
| Exact Mass | 1210.20 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(-c2c3nc(c(-c4c(F)c(F)c(-c5ccccn5)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(-c5ccccn5)c(F)c4F)c4nc(c(-c5c(F)c(F)c(-c6ccccn6)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c(F)c1-c1ccccn1 |
| InChI | InChI=1S/C64H26F16N8/c65-49-41(25-9-1-5-21-81-25)50(66)58(74)45(57(49)73)37-29-13-15-31(85-29)38(46-59(75)51(67)42(52(68)60(46)76)26-10-2-6-22-82-26)33-17-19-35(87-33)40(48-63(79)55(71)44(56(72)64(48)80)28-12-4-8-24-84-28)36-20-18-34(88-36)39(32-16-14-30(37)86-32)47-61(77)53(69)43(54(70)62(47)78)27-11-3-7-23-83-27/h1-24,85,88H/b37-29+,37-30+,38-31+,38-33+,39-32+,39-34+,40-35+,40-36+ |
| InChIKey | WUUUBJGAHNMHEA-QWIQDVOISA-N |
| XLogP | 17.80 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.94 |
| LogP ≤ 5 | 17.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|