C20H26N4O4S — CID 22721769
N-[2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]ethyl]piperidine-4-carboxamide (PubChem CID 22721769) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]ethyl]piperidine-4-carboxamide.
| Compound Name | N-[2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22721769 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[2-[[2-(naphthalen-2-ylsulfonylamino)acetyl]amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc2ccccc2c1)NCCNC(=O)C1CCNCC1 |
| InChI | InChI=1S/C20H26N4O4S/c25-19(22-11-12-23-20(26)16-7-9-21-10-8-16)14-24-29(27,28)18-6-5-15-3-1-2-4-17(15)13-18/h1-6,13,16,21,24H,7-12,14H2,(H,22,25)(H,23,26) |
| InChIKey | GKCXZRRASPATBZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|