C11H14N2O — CID 22722283
1,2,3,5,6,7-hexahydro-3,5-benzodiazonin-4-one (PubChem CID 22722283) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydro-3,5-benzodiazonin-4-one.
| Compound Name | 1,2,3,5,6,7-hexahydro-3,5-benzodiazonin-4-one |
|---|---|
| PubChem CID | 22722283 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,2,3,5,6,7-hexahydro-3,5-benzodiazonin-4-one |
| SMILES | O=C1NCCc2ccccc2CCN1 |
| InChI | InChI=1S/C11H14N2O/c14-11-12-7-5-9-3-1-2-4-10(9)6-8-13-11/h1-4H,5-8H2,(H2,12,13,14) |
| InChIKey | QDWSHVWRCITDCT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |