About octaphenyltetrasiloxane
octaphenyltetrasiloxane (PubChem CID 22722299) has the molecular formula C48H40O3Si4
and a molecular weight of 777.19 g/mol.
Molecular Properties
| Compound Name | octaphenyltetrasiloxane |
| PubChem CID | 22722299 |
| Molecular Formula | C48H40O3Si4 |
| Molecular Weight | 777.19 g/mol |
| Exact Mass | 776.21 |
| IUPAC Name | — |
| SMILES | c1ccc([Si]O[Si](O[Si](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H40O3Si4/c1-9-25-41(26-10-1)52-49-54(45-33-17-5-18-34-45,46-35-19-6-20-36-46)51-55(47-37-21-7-22-38-47,48-39-23-8-24-40-48)50-53(42-27-11-2-12-28-42,43-29-13-3-14-30-43)44-31-15-4-16-32-44/h1-40H |
| InChIKey | JLDBTILIOCQIMP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 777.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze octaphenyltetrasiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octaphenyltetrasiloxane?
The IUPAC name of octaphenyltetrasiloxane (CID 22722299) is not available.
What is the SMILES notation for octaphenyltetrasiloxane?
The canonical SMILES for octaphenyltetrasiloxane is c1ccc([Si]O[Si](O[Si](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of octaphenyltetrasiloxane?
The InChIKey is JLDBTILIOCQIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H40O3Si4/c1-9-25-41(26-10-1)52-49-54(45-33-17-5-18-34-45,46-35-19-6-20-36-46)51-55(47-37-21-7-22-38-47,48-39-23-8-24-40-48)50-53(42-27-11-2-12-28-42,43-29-13-3-14-30-43)44-31-15-4-16-32-44/h1-40H.
What are the key properties of octaphenyltetrasiloxane?
octaphenyltetrasiloxane has a molecular weight of 777.19 g/mol, XLogP of 5.16, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octaphenyltetrasiloxane is sourced from PubChem (CID 22722299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).