About [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate
[3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate (PubChem CID 22722696) has the molecular formula C26H20N2O7S
and a molecular weight of 504.52 g/mol. Its IUPAC name is [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate |
| PubChem CID | 22722696 |
| Molecular Formula | C26H20N2O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate |
| SMILES | Cc1cc(OCC2(ON3C(=O)c4ccccc4C3=O)CC2)cc(OS(=O)(=O)c2ccccc2C#N)c1 |
| InChI | InChI=1S/C26H20N2O7S/c1-17-12-19(14-20(13-17)34-36(31,32)23-9-5-2-6-18(23)15-27)33-16-26(10-11-26)35-28-24(29)21-7-3-4-8-22(21)25(28)30/h2-9,12-14H,10-11,16H2,1H3 |
| InChIKey | VNNATBSPXNUULK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 123.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate?
The IUPAC name of [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate (CID 22722696) is [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate.
What is the SMILES notation for [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate?
The canonical SMILES for [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate is Cc1cc(OCC2(ON3C(=O)c4ccccc4C3=O)CC2)cc(OS(=O)(=O)c2ccccc2C#N)c1.
What is the InChIKey of [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate?
The InChIKey is VNNATBSPXNUULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O7S/c1-17-12-19(14-20(13-17)34-36(31,32)23-9-5-2-6-18(23)15-27)33-16-26(10-11-26)35-28-24(29)21-7-3-4-8-22(21)25(28)30/h2-9,12-14H,10-11,16H2,1H3.
What are the key properties of [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate?
[3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate has a molecular weight of 504.52 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[1-(1,3-dioxoisoindol-2-yl)oxycyclopropyl]methoxy]-5-methylphenyl] 2-cyanobenzenesulfonate is sourced from PubChem (CID 22722696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).