About 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate
2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate (PubChem CID 22723846) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate |
| PubChem CID | 22723846 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate |
| SMILES | C=CC(=O)NCCOCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C11H17NO5/c1-3-10(14)12-4-5-16-6-7-17-11(15)8-9(2)13/h3H,1,4-8H2,2H3,(H,12,14) |
| InChIKey | REIAETDXSWRCRG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate?
The IUPAC name of 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate (CID 22723846) is 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate.
What is the SMILES notation for 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate?
The canonical SMILES for 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate is C=CC(=O)NCCOCCOC(=O)CC(C)=O.
What is the InChIKey of 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate?
The InChIKey is REIAETDXSWRCRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c1-3-10(14)12-4-5-16-6-7-17-11(15)8-9(2)13/h3H,1,4-8H2,2H3,(H,12,14).
What are the key properties of 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate?
2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate has a molecular weight of 243.26 g/mol, XLogP of -0.17, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(prop-2-enoylamino)ethoxy]ethyl 3-oxobutanoate is sourced from PubChem (CID 22723846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).