About 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one
2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 22723985) has the molecular formula C20H15N3O2
and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 22723985 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | O=c1c(Cc2ccccc2)nc2cccnc2n1-c1cccc(O)c1 |
| InChI | InChI=1S/C20H15N3O2/c24-16-9-4-8-15(13-16)23-19-17(10-5-11-21-19)22-18(20(23)25)12-14-6-2-1-3-7-14/h1-11,13,24H,12H2 |
| InChIKey | NUENXOMLKQVDOV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one (CID 22723985) is 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one is O=c1c(Cc2ccccc2)nc2cccnc2n1-c1cccc(O)c1.
What is the InChIKey of 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one?
The InChIKey is NUENXOMLKQVDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2/c24-16-9-4-8-15(13-16)23-19-17(10-5-11-21-19)22-18(20(23)25)12-14-6-2-1-3-7-14/h1-11,13,24H,12H2.
What are the key properties of 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one?
2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one has a molecular weight of 329.36 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 22723985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).