About triphenoxy(sulfanylidene)-λ5-stibane
triphenoxy(sulfanylidene)-λ5-stibane (PubChem CID 22724594) has the molecular formula C18H15O3SSb
and a molecular weight of 433.14 g/mol. Its IUPAC name is triphenoxy(sulfanylidene)-λ5-stibane.
Molecular Properties
| Compound Name | triphenoxy(sulfanylidene)-λ5-stibane |
| PubChem CID | 22724594 |
| Molecular Formula | C18H15O3SSb |
| Molecular Weight | 433.14 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | triphenoxy(sulfanylidene)-λ5-stibane |
| SMILES | S=[Sb](Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/3C6H6O.S.Sb/c3*7-6-4-2-1-3-5-6;;/h3*1-5,7H;;/q;;;;+3/p-3 |
| InChIKey | KKEMIWABSCXSLG-UHFFFAOYSA-K |
| XLogP | 4.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.14 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triphenoxy(sulfanylidene)-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenoxy(sulfanylidene)-λ5-stibane?
The IUPAC name of triphenoxy(sulfanylidene)-λ5-stibane (CID 22724594) is triphenoxy(sulfanylidene)-λ5-stibane.
What is the SMILES notation for triphenoxy(sulfanylidene)-λ5-stibane?
The canonical SMILES for triphenoxy(sulfanylidene)-λ5-stibane is S=[Sb](Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of triphenoxy(sulfanylidene)-λ5-stibane?
The InChIKey is KKEMIWABSCXSLG-UHFFFAOYSA-K. The full InChI is InChI=1S/3C6H6O.S.Sb/c3*7-6-4-2-1-3-5-6;;/h3*1-5,7H;;/q;;;;+3/p-3.
What are the key properties of triphenoxy(sulfanylidene)-λ5-stibane?
triphenoxy(sulfanylidene)-λ5-stibane has a molecular weight of 433.14 g/mol, XLogP of 4.86, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triphenoxy(sulfanylidene)-λ5-stibane is sourced from PubChem (CID 22724594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).