C24H23NO5 — CID 22724995
methyl 4,5-dimethoxy-2-[[(E)-2-methyl-3-naphthalen-2-ylprop-2-enoyl]amino]benzoate (PubChem CID 22724995) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[(E)-2-methyl-3-naphthalen-2-ylprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[(E)-2-methyl-3-naphthalen-2-ylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 22724995 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[(E)-2-methyl-3-naphthalen-2-ylprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)/C(C)=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23NO5/c1-15(11-16-9-10-17-7-5-6-8-18(17)12-16)23(26)25-20-14-22(29-3)21(28-2)13-19(20)24(27)30-4/h5-14H,1-4H3,(H,25,26)/b15-11+ |
| InChIKey | QUUHRQMFBZCZAR-RVDMUPIBSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|