C27H51N3O4 — CID 22725774
2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid (PubChem CID 22725774) has the molecular formula C27H51N3O4 and a molecular weight of 481.72 g/mol. Its IUPAC name is 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 22725774 |
| Molecular Formula | C27H51N3O4 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.39 |
| IUPAC Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CN1C(C)(C)CC(OC(=O)NCCCCC(C(=O)O)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C27H51N3O4/c1-24(2)15-19(16-25(3,4)29(24)9)21(22(31)32)13-11-12-14-28-23(33)34-20-17-26(5,6)30(10)27(7,8)18-20/h19-21H,11-18H2,1-10H3,(H,28,33)(H,31,32) |
| InChIKey | LZISEJVITQRTAY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|