About bis(3-methylhexan-3-yl) butanedioate
bis(3-methylhexan-3-yl) butanedioate (PubChem CID 22726145) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is bis(3-methylhexan-3-yl) butanedioate.
Molecular Properties
| Compound Name | bis(3-methylhexan-3-yl) butanedioate |
| PubChem CID | 22726145 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | bis(3-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(C)(CC)OC(=O)CCC(=O)OC(C)(CC)CCC |
| InChI | InChI=1S/C18H34O4/c1-7-13-17(5,9-3)21-15(19)11-12-16(20)22-18(6,10-4)14-8-2/h7-14H2,1-6H3 |
| InChIKey | ZVIRJBTVCCUVIV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(3-methylhexan-3-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylhexan-3-yl) butanedioate?
The IUPAC name of bis(3-methylhexan-3-yl) butanedioate (CID 22726145) is bis(3-methylhexan-3-yl) butanedioate.
What is the SMILES notation for bis(3-methylhexan-3-yl) butanedioate?
The canonical SMILES for bis(3-methylhexan-3-yl) butanedioate is CCCC(C)(CC)OC(=O)CCC(=O)OC(C)(CC)CCC.
What is the InChIKey of bis(3-methylhexan-3-yl) butanedioate?
The InChIKey is ZVIRJBTVCCUVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-7-13-17(5,9-3)21-15(19)11-12-16(20)22-18(6,10-4)14-8-2/h7-14H2,1-6H3.
What are the key properties of bis(3-methylhexan-3-yl) butanedioate?
bis(3-methylhexan-3-yl) butanedioate has a molecular weight of 314.47 g/mol, XLogP of 4.79, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylhexan-3-yl) butanedioate is sourced from PubChem (CID 22726145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).