C28H26O3S — CID 22726286
(2,4,6-trimethyl-3,5-diphenylphenyl) 4-methylbenzenesulfonate (PubChem CID 22726286) has the molecular formula C28H26O3S and a molecular weight of 442.58 g/mol. Its IUPAC name is (2,4,6-trimethyl-3,5-diphenylphenyl) 4-methylbenzenesulfonate.
| Compound Name | (2,4,6-trimethyl-3,5-diphenylphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22726286 |
| Molecular Formula | C28H26O3S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2,4,6-trimethyl-3,5-diphenylphenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C)c(-c3ccccc3)c(C)c(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C28H26O3S/c1-19-15-17-25(18-16-19)32(29,30)31-28-21(3)26(23-11-7-5-8-12-23)20(2)27(22(28)4)24-13-9-6-10-14-24/h5-18H,1-4H3 |
| InChIKey | UIFZDLKCBJCKLZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|