C14H28O3Si — CID 22726340
triethoxy-[(1E)-octa-1,7-dienyl]silane (PubChem CID 22726340) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is triethoxy-[(1E)-octa-1,7-dienyl]silane.
| Compound Name | triethoxy-[(1E)-octa-1,7-dienyl]silane |
|---|---|
| PubChem CID | 22726340 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | triethoxy-[(1E)-octa-1,7-dienyl]silane |
| SMILES | C=CCCCC/C=C/[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H28O3Si/c1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h5,13-14H,1,6-12H2,2-4H3/b14-13+ |
| InChIKey | IJZMXUOFUYKSCK-BUHFOSPRSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|