About 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde
6-methylidenecyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 22726424) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 22726424 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | C=C1CC=CC=C1C=O |
| InChI | InChI=1S/C8H8O/c1-7-4-2-3-5-8(7)6-9/h2-3,5-6H,1,4H2 |
| InChIKey | QIRUZRGASIZCEY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde (CID 22726424) is 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde is C=C1CC=CC=C1C=O.
What is the InChIKey of 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is QIRUZRGASIZCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-7-4-2-3-5-8(7)6-9/h2-3,5-6H,1,4H2.
What are the key properties of 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde?
6-methylidenecyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 120.15 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidenecyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 22726424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).