C29H34N2O4 — CID 22726487
3-[2-(3-benzyl-5-methyl-2-oxo-1-pyridinyl)hexanoylamino]-3-(4-methylphenyl)propanoic acid (PubChem CID 22726487) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[2-(3-benzyl-5-methyl-2-oxo-1-pyridinyl)hexanoylamino]-3-(4-methylphenyl)propanoic acid.
| Compound Name | 3-[2-(3-benzyl-5-methyl-2-oxo-1-pyridinyl)hexanoylamino]-3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22726487 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[2-(3-benzyl-5-methyl-2-oxo-1-pyridinyl)hexanoylamino]-3-(4-methylphenyl)propanoic acid |
| SMILES | CCCCC(C(=O)NC(CC(=O)O)c1ccc(C)cc1)n1cc(C)cc(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C29H34N2O4/c1-4-5-11-26(28(34)30-25(18-27(32)33)23-14-12-20(2)13-15-23)31-19-21(3)16-24(29(31)35)17-22-9-7-6-8-10-22/h6-10,12-16,19,25-26H,4-5,11,17-18H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | JGLAPEKGWHWWRD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |