methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate

C8H11N3O4S — CID 22726932

IUPACmethyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate
SMILESCCOC(=O)Nc1nc(CC(=O)OC)ns1
InChIInChI=1S/C8H11N3O4S/c1-3-15-8(13)10-7-9-5(11-16-7)4-6(12)14-2/h3-4H2,1-2H3,(H,9,10,11,13)
InChIKeyWRUIUWMHBQJODA-UHFFFAOYSA-N
MW245.26 g/mol
LogP0.82
Rot. Bonds4

About methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate

methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate (PubChem CID 22726932) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate
PubChem CID22726932
Molecular FormulaC8H11N3O4S
Molecular Weight245.26 g/mol
Exact Mass245.05
IUPAC Namemethyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate
SMILESCCOC(=O)Nc1nc(CC(=O)OC)ns1
InChIInChI=1S/C8H11N3O4S/c1-3-15-8(13)10-7-9-5(11-16-7)4-6(12)14-2/h3-4H2,1-2H3,(H,9,10,11,13)
InChIKeyWRUIUWMHBQJODA-UHFFFAOYSA-N
XLogP0.82
TPSA90.41 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.26
LogP ≤ 50.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate?
The IUPAC name of methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate (CID 22726932) is methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate.
What is the SMILES notation for methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate?
The canonical SMILES for methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate is CCOC(=O)Nc1nc(CC(=O)OC)ns1.
What is the InChIKey of methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate?
The InChIKey is WRUIUWMHBQJODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4S/c1-3-15-8(13)10-7-9-5(11-16-7)4-6(12)14-2/h3-4H2,1-2H3,(H,9,10,11,13).
What are the key properties of methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate?
methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate has a molecular weight of 245.26 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate is sourced from PubChem (CID 22726932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).