About 6-chloropyrido[3,4-d]pyrimidine
6-chloropyrido[3,4-d]pyrimidine (PubChem CID 22727455) has the molecular formula C7H4ClN3
and a molecular weight of 165.58 g/mol. Its IUPAC name is 6-chloropyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-chloropyrido[3,4-d]pyrimidine |
| PubChem CID | 22727455 |
| Molecular Formula | C7H4ClN3 |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | 6-chloropyrido[3,4-d]pyrimidine |
| SMILES | Clc1cc2cncnc2cn1 |
| InChI | InChI=1S/C7H4ClN3/c8-7-1-5-2-9-4-11-6(5)3-10-7/h1-4H |
| InChIKey | OGOPAVRSPJYRLS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloropyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloropyrido[3,4-d]pyrimidine?
The IUPAC name of 6-chloropyrido[3,4-d]pyrimidine (CID 22727455) is 6-chloropyrido[3,4-d]pyrimidine.
What is the SMILES notation for 6-chloropyrido[3,4-d]pyrimidine?
The canonical SMILES for 6-chloropyrido[3,4-d]pyrimidine is Clc1cc2cncnc2cn1.
What is the InChIKey of 6-chloropyrido[3,4-d]pyrimidine?
The InChIKey is OGOPAVRSPJYRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3/c8-7-1-5-2-9-4-11-6(5)3-10-7/h1-4H.
What are the key properties of 6-chloropyrido[3,4-d]pyrimidine?
6-chloropyrido[3,4-d]pyrimidine has a molecular weight of 165.58 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloropyrido[3,4-d]pyrimidine is sourced from PubChem (CID 22727455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).