About 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol
3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol (PubChem CID 22727960) has the molecular formula C16H11N3O2
and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol.
Molecular Properties
| Compound Name | 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol |
| PubChem CID | 22727960 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol |
| SMILES | Oc1cccc(-n2cnc3cc(-c4ccoc4)cnc32)c1 |
| InChI | InChI=1S/C16H11N3O2/c20-14-3-1-2-13(7-14)19-10-18-15-6-12(8-17-16(15)19)11-4-5-21-9-11/h1-10,20H |
| InChIKey | LWSYQMBKWUTZAR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol?
The IUPAC name of 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol (CID 22727960) is 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol.
What is the SMILES notation for 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol?
The canonical SMILES for 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol is Oc1cccc(-n2cnc3cc(-c4ccoc4)cnc32)c1.
What is the InChIKey of 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol?
The InChIKey is LWSYQMBKWUTZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2/c20-14-3-1-2-13(7-14)19-10-18-15-6-12(8-17-16(15)19)11-4-5-21-9-11/h1-10,20H.
What are the key properties of 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol?
3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol has a molecular weight of 277.28 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(furan-3-yl)imidazo[4,5-b]pyridin-3-yl]phenol is sourced from PubChem (CID 22727960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).