About 1-ethenylpurine
1-ethenylpurine (PubChem CID 22728280) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-ethenylpurine.
Molecular Properties
| Compound Name | 1-ethenylpurine |
| PubChem CID | 22728280 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1-ethenylpurine |
| SMILES | C=Cn1cnc2ncnc-2c1 |
| InChI | InChI=1S/C7H6N4/c1-2-11-3-6-7(10-5-11)9-4-8-6/h2-5H,1H2 |
| InChIKey | BTHFVSCNWFBKPY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethenylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpurine?
The IUPAC name of 1-ethenylpurine (CID 22728280) is 1-ethenylpurine.
What is the SMILES notation for 1-ethenylpurine?
The canonical SMILES for 1-ethenylpurine is C=Cn1cnc2ncnc-2c1.
What is the InChIKey of 1-ethenylpurine?
The InChIKey is BTHFVSCNWFBKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-11-3-6-7(10-5-11)9-4-8-6/h2-5H,1H2.
What are the key properties of 1-ethenylpurine?
1-ethenylpurine has a molecular weight of 146.15 g/mol, XLogP of 0.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpurine is sourced from PubChem (CID 22728280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).